Potassium 5-formylthiophene-3-trifluoroborate
Potassium 5-formylthiophene-3-trifluoroborate is utilized in the biomedical industry for its therapeutic properties. It is commonly employed in the development of drugs targeting various diseases, such as cancer and neurological disorders. This compound plays a crucial role in the synthesis of pharmaceutical agents that possess promising efficacy in treating these ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 907604-61-9 |
| Pricing | Inquire |
| Cas | 907604-61-9 |
| Molecular Weight | 218.05 |
| Molecular Formula | C5H3BF3KOS |
| Canonical SMILES | [B-](C1=CSC(=C1)C=O)(F)(F)F.[K+] |