8-Hydroxyquinoline b-D-glucopyranoside
8-Hydroxyquinoline b-D-glucopyranoside is a commendable biomedical compound known for its applications in studying neurodegenerative ailments. By fortifying the cellular antioxidant defense system and impeding neuroinflammation, it showcases promising neuroprotective attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29266-96-4 |
| Pricing | Inquire |
| Cas | 29266-96-4 |
| Molecular Weight | 307.3 |
| Molecular Formula | C15H17NO6 |
| Canonical SMILES | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)N=CC=C2 |