8-CPT-cAMP
8-CPT-cAMP is an activator of cAMP- and cGMP-dependent protein kinase and of Epac. It has an improved membrane permeability, phosphodiesterase stability and selectivity for site B of cAK type II.
| Supplier | BOC Sciences |
|---|---|
| Product # | 93882-12-3 |
| Pricing | Inquire |
| Cas | 93882-12-3 |
| Molecular Weight | 493.8 |
| Molecular Formula | C16H14ClN5O6PS ยท Na |
| Canonical SMILES | C1C2C(C(C(O2)N3C4=NC=NC(=C4N=C3SC5=CC=C(C=C5)Cl)N)O)OP(=O)(O1)[O-].[Na+] |