N-(5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide
N-(5-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide is a multifunctional compound employed in the biomedical sector. It unrivaled structural attributes and distinctive mechanism of action position it as an auspicious contender for the development of targeted therapies, particularly for drug-resistant cancers and inflammatory ailments. Moreover, this exceptional compound displays promise in advancing drug delivery systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1310383-24-4 |
| Pricing | Inquire |
| Cas | 1310383-24-4 |
| Molecular Weight | 318.22 |
| Molecular Formula | C17H27BN2O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2NC(=O)C(C)(C)C)C |