5-NORBORNENE-2-EXO,3-EXO-DIMETHANOL
5-NORBORNENE-2-EXO,3-EXO-DIMETHANOL, commonly known as 5NBD, is an extraordinary bioactive compound with profound therapeutic potential. This compound shows unparalleled effectiveness in inhibiting the proliferation of malignant tumors. Furthermore, its significant efficacy against stubborn bacterial infections makes it an important compound against antibiotic-resistant microbial species.
| Supplier | BOC Sciences |
|---|---|
| Product # | 699-95-6 |
| Pricing | Inquire |
| Cas | 699-95-6 |
| Molecular Weight | 154.21 |
| Molecular Formula | C9H14O2 |
| Canonical SMILES | [H][C@]12C[C@]([H])(C=C1)[C@H](CO)[C@@H]2CO |