2-(D-Arabino-tetrahydroxybutyl)-4(R)-1,3-thiazolidine-4-carboxylic acid
2-(D-Arabino-tetrahydroxybutyl)-4(R)-1,3-thiazolidine-4-carboxylic acid, a crucial compound within the biomedicine sector, exhibits significant scientific relevance. This compound finds extensive application in combating diverse bacterial infections in humans. Leveraging its potent antimicrobial attributes, it proves efficacious against an extensive array of drug-resistant strains. Its mode of operation entails hindering the synthesis of vital proteins indispensable for bacterial proliferation, thereby facilitating the complete eradication of such infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110270-13-8 |
| Pricing | Inquire |
| Cas | 110270-13-8 |
| Molecular Weight | 253.27 |
| Molecular Formula | C8H15NO6S |
| Canonical SMILES | C1C(NC(S1)C(C(C(CO)O)O)O)C(=O)O |