5-Chloro-2-(methylsulfonyl)pyrimidine-4-carboxylic Acid
PK11007 is an antitumor agent that targets and stabilizes wild type and mutant p53 via selective alkylation of two surface-exposed cysteines without compromising its DNA binding activity. It blocks cell migration and induces apoptosis in various cancer cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38275-34-2 |
| Pricing | Inquire |
| Cas | 38275-34-2 |
| Molecular Weight | 236.63 |
| Molecular Formula | C6H5ClN2O4S |
| Canonical SMILES | CS(=O)(=O)C1=NC=C(C(=N1)C(=O)O)Cl |