CP-199330 Sodium
The sodium salt form of CP-199330 which is a chromen derivative and has been found to be a Leukotriene D4 receptor antagonist that was once studied against asthma by Pfizer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 158102-98-8 |
| Pricing | Inquire |
| Cas | 158102-98-8 |
| Molecular Weight | 630.99 |
| Molecular Formula | C28H23ClF3N2NaO6S |
| Canonical SMILES | COC1=C(C=C(C=C1)[N-]S(=O)(=O)C(F)(F)F)CC2COC3=C(C2O)C=C(C=C3)OCC4=NC5=C(C=CC(=C5)Cl)C=C4.[Na+] |