PERFUORO(ALLYLBENZENE), 97%
Perfluoro(allylbenzene), with a purity of 97%, is a valuable compound used in the biomedical industry. Primarily utilized in research and development, this product acts as a crucial building block for the synthesis of drug candidates targeting specific diseases such as cancer and neurodegenerative disorders. Its high purity ensures reliable and reproducible results for pharmaceutical advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 67899-41-6 |
| Pricing | Inquire |
| Cas | 67899-41-6 |
| Molecular Weight | 298.08 |
| Molecular Formula | C9F10 |
| Canonical SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=C(F)F)F)(F)F |