N4-Acetyl-3'-O-acetyl-2'-deoxycytidine
N4-Acetyl-3'-O-acetyl-2'-deoxycytidine, a remarkable compound widely utilized in the realm of biomedicine, showcases immense promise in combatting an array of maladies. This product occupies a pivotal stance in the innovation of novel antiviral therapeutics directed towards insidious viral afflictions like hepatitis C and HIV. It exerts a profound impact by stifling viral replication, thus conferring therapeutic advantages to individuals grappling with these formidable viral adversaries.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70284-47-8 |
| Pricing | Inquire |
| Cas | 70284-47-8 |
| Molecular Weight | 311.29 |
| Molecular Formula | C13H17N3O6 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2CC(C(O2)CO)OC(=O)C |