Sodium Erythorbate
| Supplier | CD Formulation |
|---|---|
| Product # | CDC10-0071 |
| CAS # | 228-973-9 |
| Pricing | 1 kg, Inquire for price |
| Image | 6381-77-7 |
| product1 | Cosmetic Ingredients |
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Molecular Formula | C6H7NaO6•H2O |
| Boiling Point | 552.7ºC at 760 mmHg |
| Melting Point | 168 - 170ºC |
| Density | 1.954 g/cm3 |
| Molecular Weight (g/mol) | 198.106 |
| Synonyms | 3-keto-d-gulofuranolactose;erbitn;eribaten;isoascorbic;isona;mercate20;D-erythro-Hex-2-enonic acid, .gamma.-lactone, sodium salt (1:1);2,3-Didehydro-3-O-sodio-D-erythro-hexono-1,4-lactone |
| CAS Number | 6381-77-7 |
| Category | Antioxidant Cosmetic Chemicals |
| Flash Point | 238.2ºC |
| Refractive Index | 97 ° (C=10, H2O) |
| Purity | 0.99 |
| SMILES | O=C1C(O)=C(O)[C@]([C@H](O)CO)([H])O1.[Na+] |
| Physical State | Solid |
| RTECS | MP8910000 |