BSH-IN-1
BSH-IN-1 is a covalent inhibitor of bile salt hydrolases. BSH-IN-1 inhibits the bile salt hydrolases of the Gram-negative bacterium B. theta and the Gram-positive bacterium B. longum (IC50s = 427 and 108 nM, respectively). It also inhibits deconjugation of bile acids in a variety of bacteria and in resuspended mouse feces.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2553217-91-5 |
| Pricing | Inquire |
| Cas | 2553217-91-5 |
| Molecular Weight | 408.59 |
| Molecular Formula | C25H41FO3 |
| Canonical SMILES | CC(CCC(=O)CF)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |