3'-O-tert-Butyldimethylsilyl-2'-deoxyadenosine
3'-O-tert-Butyldimethylsilyl-2'-deoxyadenosine is a valuable reagent widely used in biomedical research, primarily utilized in the synthesis of nucleosides and nucleotides for studying DNA and RNA structures. Additionally, it finding application in drug design and discovery, targeting diseases such as cancer, viral infections is and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51549-31-6 |
| Pricing | Inquire |
| Cas | 51549-31-6 |
| Molecular Weight | 365.50 |
| Molecular Formula | C16H27N5O3Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1CC(OC1CO)N2C=NC3=C(N=CN=C32)N |