Vitamin B2 phosphate
Riboflavin phosphate, also known as riboflavin-5'-phosphate or flavin mononucleotide (FMN), is the active form of vitamin B2 (riboflavin) that is essential for various biochemical processes in the body. FMN serves as a cofactor for several enzymes, including those involved in the electron transport chain in mitochondria, where ATP (cellular energy) is generated. It participates in the metabolism of fats, carbohydrates, and proteins, aiding in their breakdown and utilization for energy. Riboflavin phosphate is available as a dietary supplement, typically in the form of FMN or as part of a vitamin B complex supplement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 146-17-8 |
| Pricing | Inquire |
| Cas | 146-17-8 |
| Molecular Weight | 456.34 |
| Molecular Formula | C17H21N4O9P |
| Canonical SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O |