6-Chloro-2-(tributylstannyl)pyridine
6-Chloro-2-(tributylstannyl)pyridine is an immensely significant compound extensively employed in the biomedical industry, showcases its immense versatility in various drug synthesis applications, from antivirals to antineoplastics and antibiotics. Furthermore, owing to its exceptional attributes and extraordinary structure, this compound remarkably aids in the drug development of specific ailments like viral infections and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 263698-99-3 |
| Pricing | Inquire |
| Cas | 263698-99-3 |
| Molecular Weight | 402.58 |
| Molecular Formula | C17H30ClNSn |
| Canonical SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC=CC(=N1)Cl |