6″-O-Acetylsaikosaponin b3
6″-O-Acetylsaikosaponin b3 is a formidable natural compound widely applied in the research of a diverse range of afflictions such as arthritis is asthma and even cancer. Its exceptional prowess lies in its remarkable anti-inflammatory and antioxidant attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7209 |
| Pricing | Inquire |
| Cas | 104109-34-4 |
| Molecular Weight | 855.074 |
| Molecular Formula | C45H74O15 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C(C=C5C4(CC(C6(C5CC(CC6)(C)C)CO)O)C)OC)C)C)O)OC7C(C(C(C(O7)COC(=O)C)O)O)O)O |