NG,NG-dimethyl-L-arginine hydrochloride
NG,NG-dimethyl-L-arginine (ADMA) is an endogenous nitric oxide synthase (NOS) inhibitor. ADMA interferes with L-arginine in the production of nitric oxide (NO), a key chemical involved in normal endothelial function and, by extension, cardiovascular health.
| Supplier | BOC Sciences |
|---|---|
| Product # | 220805-22-1 |
| Pricing | Inquire |
| Cas | 220805-22-1 |
| Molecular Weight | 275.2 |
| Molecular Formula | C8H18N4O2ยท2HCl |
| Canonical SMILES | CN(C)C(=NCCCC(C(=O)O)N)N.Cl.Cl |