Caffeic acid-[13C9]
Caffeic acid-[13C9] is the carbon-13 labelled edition of Caffeic acid. Caffeic Acid is an orally bioavailable, hydroxycinnamic acid derivative and polyphenol, with potential anti-oxidant, anti-inflammatory, and antineoplastic activities. Upon administration, caffeic acid acts as an antioxidant and prevents oxidative stress, thereby preventing DNA damage induced by free radicals.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-000126 |
| Pricing | Inquire |
| Cas | 1173097-51-2 |
| Molecular Weight | 189.09 |
| Molecular Formula | C3[13C]6H8O4 |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)O)O)O |