3'-Chloro-3'-deoxy-5'-O-tritylthymidine
3'-Chloro-3'-deoxy-5'-O-tritylthymidine, widely recognized in the biomedical sector, serves as a pivotal entity. Its application as a forerunner in the amalgamation of antiviral medications, addressing a myriad of ailments like HIV and hepatitis C, renders it indispensable.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34627-62-8 |
| Pricing | Inquire |
| Cas | 34627-62-8 |
| Molecular Weight | 502.99 |
| Molecular Formula | C29H27ClN2O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)Cl |