6-Dehydro Prednisolone
6-Dehydro Prednisolone (Prednisolone EP Impurity H) is a metabolite of Prednisolone, which is a synthetic glucocorticoid, a derivative of cortisol, and can be used to treat a variety of inflammatory and auto-immune conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2427-64-7 |
| Pricing | Inquire |
| Cas | 2427-64-7 |
| Molecular Weight | 358.43 |
| Molecular Formula | C21H26O5 |
| Canonical SMILES | CC12CC(C3C(C1CCC2(C(=O)CO)O)C=CC4=CC(=O)C=CC34C)O |