Benzyl-PEG2-acid
Benzyl-PEG2-acid is a PEG linker containing a benzyl protecting group and a carboxylic acid group. Benzyl is an alcohol protecting group and can be removed via hydrogenolysis. The carboxylic acid group can react with primary amine groups in the presence of activators such as EDC or HATU to form a stable amide bond.
Supplier | BOC Sciences |
---|---|
Product # | BP-500910 |
Pricing | Inquire |
Cas | 91555-65-6 |
Molecular Weight | 224.25 |
Molecular Formula | C12H16O4 |
Canonical SMILES | C1=CC=C(C=C1)COCCOCCC(=O)O |