4-Ethoxybenzylzinc chloride solution
4-Ethoxybenzylzinc chloride solution is a highly potent reagent employed in the intricate synthesis of organic compounds, and demonstrates exceptional versatility as a nucleophile. By forging carbon-carbon bonds with diverse electrophiles, it showcases its remarkable aptitude. Embracing an array of domains, encompassing pharmaceuticals, agrochemicals, and fine chemicals, this commendable solution assumes a pivotal role in the realm of drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 308796-29-4 |
| Pricing | Inquire |
| Cas | 308796-29-4 |
| Molecular Weight | 236.03 |
| Molecular Formula | C2H5OC6H4CH2ZnCl |
| Canonical SMILES | CCOC1=CC=C(C=C1)[CH2-].Cl[Zn+] |