N6-L-Lysyl-L-lysine
N6-L-Lysyl-L-lysine is a dimer of DL-Lysine (L488505). DL-Lysine is a racemic mixture of the D and L enantiomers of lysine amino acid. Used in the synthesis of proteins, alkaloids and other chemical compounds. Used as a precursor in biosynthesis of Marcfortine A.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB060451 |
| Pricing | Inquire |
| Cas | 94613-75-9 |
| Molecular Weight | 274.36 |
| Molecular Formula | C12H26N4O3 |
| Canonical SMILES | C(CCN)CC(C(=O)NCCCCC(C(=O)O)N)N |