Gallic acid
Gallic acid is a natural phenolic compound, it has cytotoxic activity in relation to their radical modulating activity, induce apoptosis by different mechanisms, and gallic acid produces higher amounts of radicals and more efficiently scavenged the superoxide anion radical. Gallic acid also exhibits the activitise of anti-tyrosinase,antioxidant and anti-inflammatory.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5252 |
| Pricing | Inquire |
| Cas | 149-91-7 |
| Molecular Weight | 170.12 |
| Molecular Formula | C7H6O5 |
| Canonical SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)O |