6-Amino-6-deoxy-D-glucose hydrochloride
6-Amino-6-deoxy-D-glucose hydrochloride, a highly significant compound within the field of biomedicine, exhibits immense value. Renowned for its indispensable role in glycoprotein and glycoconjugate synthesis, this particular product emerges as a pivotal catalyst in the quest for novel therapies pertaining to conditions such as cancer, diabetes, and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55324-97-5 |
| Pricing | Inquire |
| Cas | 55324-97-5 |
| Molecular Weight | 215.63 |
| Molecular Formula | C6H14ClNO5 |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)N.Cl |