Thalidomide-linker 5
Thalidomide-linker 5 is a crosslinker−E3 ligase ligand conjugate composed of a cereblon-recuiting ligand thalidomide and a PEGylated crosslinker. It has been used as a degrader building block in PROTAC for targeted protein degradation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2098487-52-4 |
| Pricing | Inquire |
| Cas | 2098487-52-4 |
| Molecular Weight | 400.38 |
| Molecular Formula | C20H20N2O7 |
| Canonical SMILES | C#CCOCCOCCOC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |