POLY-D-GLUTAMIC ACID SODIUM SALT
POLY-D-GLUTAMIC ACID SODIUM SALT is a remarkable biomedical agent that demonstrates unparalleled potential as a drug delivery system in the realm of cancer therapeutics. Leveraging its inherent biocompatibility and remarkable aqueous solubility, this extraordinary compound effectively enwraps anti-cancer medications, thereby augmenting their potency whilst mitigating undesirable repercussions. Additionally, its profound capability in targeted therapy across heterogeneous cancer variants underscores its profound promise as an invaluable weapon in combatting the scourge of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 30811-79-1 |
| Pricing | Inquire |
| Cas | 30811-79-1 |
| Molecular Formula | [CO(CH2)2CH(CO2H)NH]n |
| Canonical SMILES | C(CC(=O)O)C(C(=O)[O-])N.[Na+] |