1,6-Di-O-galloyl-b-D-glucopyranose
1,6-Di-O-galloyl-b-D-glucopyranose, a versatile natural compound, holds immense potential in the field of biomedicine for the treatment of a diverse range of ailments. Renowned for its robust antioxidative and anti-inflammatory attributes, this compound excels in mitigating disorders associated with oxidative stress, including heart ailments and neurodegenerative conditions. Notably, its exceptional anticancer efficacy positions it as a viable therapeutic avenue for combating malignant growths.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23363-08-8 |
| Pricing | Inquire |
| Cas | 23363-08-8 |
| Molecular Weight | 484.37 |
| Molecular Formula | C20H20O14 |
| Canonical SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |