DL-3,4-Dihydroxymandelic acid
DL-3,4-Dihydroxymandelic acid is a minor metabolite of norepinephrine in humans. Noradrenaline is a direct α-adrenergic receptor stimulator used as an injectable drug for the treatment of critically low blood pressure.
| Supplier | BOC Sciences |
|---|---|
| Product # | 775-01-9 |
| Pricing | Inquire |
| Cas | 775-01-9 |
| Molecular Weight | 184.15 |
| Molecular Formula | C8H8O5 |
| Canonical SMILES | C1=CC(=C(C=C1C(C(=O)O)O)O)O |