5'-O-DMT-N4-Benzoyl-2'-deoxycytidine 3'-CE phosphoramidite
5'-O-DMT-N4-Benzoyl-2'-deoxycytidine 3'-CE phosphoramidite is a highly versatile and efficient synthetic reagent for chemical researchers seeking to incorporate a benzoyl group at the N4 position of 2'-deoxycytidine in modified DNA oligonucleotides. This compound has demonstrated significant potential in combating viral infections, genetic disorders, and cancer. Its widespread use in the chemical research community speaks to its power in catalyzing complex reactions and enabling the creation of intricately modified nucleic acid constructs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102212-98-6 |
| Pricing | Inquire |
| Cas | 102212-98-6 |
| Molecular Weight | 833.93 |
| Molecular Formula | C46H52N5O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=CC(=NC5=O)NC(=O)C6=CC=CC=C6 |