Cortistatin-17 (human)
Cortistatin-17, a structural analogue of somatostatin, binds to all somatostatin receptor subtypes (SSTR) in a manner similar to rat cortistatin. Its inhibition on the cAMP production of forskolin-stimulated in chinese hamster ovary cells expressing SSTR2-5 are dose-dependent, but slightly less efficient than somatostatin-14. Like rat cortistatin, it affects sleep and wake patterns in rats. It reduces light slow wave sleep (SWS1) and increases deep slow wave sleep (SWS2) in a dose-dependent manner. Administration of the peptide causes a temporary flattening of cortical and hippocampal electroencephalograms.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015261 |
| Pricing | Inquire |
| Cas | 189450-19-9 |
| Molecular Weight | 2151.53 |
| Molecular Formula | C96H139N27O24S3 |
| Canonical SMILES | CC(C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=CC=C4)CC5=CC=CC=C5)CC(=O)N)CCCNC(=N)N)NC(=O)C6CCCN6C(=O)C(CCSC)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(=O)O)N)C(=O)NC(CCCCN)C(=O)O)CO)CO)CC7=CC=CC=C7)O |