Fexofenadine EP Impurity E
Fexofenadine EP Impurity E is an impurity of Fexofenadine, which is a histamine H1 receptor antagonist used for the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115-46-8 |
| Pricing | Inquire |
| Cas | 115-46-8 |
| Molecular Weight | 267.37 |
| Molecular Formula | C18H21NO |
| Canonical SMILES | C1CNCCC1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |