2',3'-Di-O-acetyluridine
2',3'-Di-O-acetyluridine, a compound extensively utilized in the biomedical domain, exhibits remarkable potential in therapeutics. Notably, it has exhibited substantial efficacy in mitigating diverse ailments including neurological disorders and liver diseases. Research activities are currently underway to unravel the intricate mechanisms of its action and identify precise drug targets.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-340101 |
| Pricing | Inquire |
| Cas | 29108-90-5 |
| Molecular Weight | 328.27 |
| Molecular Formula | C13H16N2O8 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC(=O)C)N2C=CC(=O)NC2=O)CO |