G-Protein antagonist peptide
| Supplier | Creative Peptides |
|---|---|
| Product # | R0855 |
| CAS # | 143675-79-0 |
| Pricing | Inquire |
| Synonyms | GPAnt-2 |
| MolecularFormula | C57H64N12O9S |
| MolecularWeight | 1093.27 |
| Sequence | Pyr-Gln-D-Trp-Phe-D-Trp-D-Trp-Met-NH2 |
| Storage | -20°C |
| Explanation | Substance P-related peptide which inhibits the binding of G protein to its receptor. Competitively and reversibly inhibits M2 muscarinic receptor activation of Gi or Go and inhibits Gs activation by β-adrenoceptors. |
| Activity | Inhibitor |
| InChI | InChI=1S/C57H64N12O9S/c1-79-24-23-42(51(59)72)64-55(76)46(26-33-29-60-39-16-8-5-13-36(33)39)69-57(78)48(28-35-31-62-41-18-10-7-15-38(35)41)68-54(75)45(25-32-11-3-2-4-12-32)66-56(77)47(27-34-30-61-40-17-9-6-14-37(34)40)67-53(74)44(19-21-49(58)70)65-52(73)43-20-22-50(71)63-43/h2-18,29-31,42-48,60-62H,19-28H2,1H3,(H2,58,70)(H2,59,72)(H,63,71)(H,64,76)(H,65,73)(H,66,77)(H,67,74)(H,68,75)(H,69,78)/t42-,43-,44-,45-,46+,47+,48+/m0/s1 |
| InChIKey | WSYRBHQWMXTCHQ-SFIKJRKMSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | CSCC[C@@H](C(=O)N)NC(=O)[C@@H](CC1=CNC2=CC=CC=C21)NC(=O)[C@@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CC=CC=C5)NC(=O)[C@@H](CC6=CNC7=CC=CC=C76)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H]8CCC(=O)N8 |
| Appearance | White solid powder |
| Purity | >98 % |
| LongTermStorageConditions | -20 °C |