2-Naphthyl b-D-glucuronide sodium salt
2-Naphthyl b-D-glucuronide sodium salt, a highly useful compound utilized in the field of biomedical research and pharmaceutical advancement, plays a pivotal role. It prominently serves as an imperative substrate in enzymatic assays, thereby contributing significantly to the exploration of glucuronidation reactions. Its paramount significance lies in its ability to effectively facilitate the examination of diverse diseases and drug metabolism. Its exceptional quality as a sodium salt offers researchers a dependable means to evaluate drug efficacy and to assess glucuronidation activities meticulously.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20838-64-6 |
| Pricing | Inquire |
| Cas | 20838-64-6 |
| Molecular Weight | 342.28 |
| Molecular Formula | C16H15NaO7 |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)OC3C(C(C(C(O3)C(=O)[O-])O)O)O.[Na+] |