2-(2-(2-(Benzyloxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate
2-(2-(2-(Benzyloxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate is a PEG linker with an acid labile, benzyl protecting group. The tosyl group is a good leaving group. The hydrophilic PEG linker increases the water solubility of the compound in aqueous solutions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-1228 |
| Pricing | Inquire |
| Cas | 84131-04-4 |
| Molecular Weight | 394.48 |
| Molecular Formula | C20H26O6S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCC2=CC=CC=C2 |