Fludarabine Phosphate EP Impurity H
An impurity of Fludarabine Phosphate. Fludarabine Phosphate is an analogue of adenosine and deoxyadenosine, which is able to compete with dATP for incorporation into DNA and inhibit DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 548774-57-8 |
| Pricing | Inquire |
| Cas | 548774-57-8 |
| Molecular Weight | 267.22 |
| Molecular Formula | C10H10FN5O3 |
| Canonical SMILES | C1C2C(C(O1)C(O2)N3C=NC4=C(N=C(N=C43)F)N)O |