MMP-8 Inhibitor I
MMP-8 Inhibitor I is a selective and cell-permeable inhibitor of matrix metalloproteinase-8 (MMP-8) with IC50 value of 4 nM. MMP-8 is a neutrophil collagenase that cleaves interstitial collagens. MMP-8 is associated with diseases including arthritis, cancer, osteoporosis and arteriosclerosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 236403-25-1 |
| Pricing | Inquire |
| Cas | 236403-25-1 |
| Molecular Weight | 362.4 |
| Molecular Formula | C17H18N2O5S |
| Canonical SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CC3=CC=CC=C3CC2C(=O)NO |