Saccharocarcin B
An unusual tetronic acid structurally related to kijanimicin, chlorothricin, tetrocarcin and versipelostatin; has pronounced activity against gram positive bacteria and chlamydia trachomatis; inhibits transcription from the promoter of GRP78; appears to target the phosphatidylinositide-3-kinase/akt signalling pathway.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02641 |
| Pricing | Inquire |
| Cas | 158475-33-3 |
| Molecular Weight | 1254.54 |
| Molecular Formula | C68H103NO20 |
| Canonical SMILES | CCCC1CC23C(C=C1)C=C(C(C(C=C(C4C=CC5C(C4(C(=C(C2=O)C(=O)O3)O)C)C(CC(C5OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)O)O)O)OC9CCC(C(O9)C)O)C)C)C)C)OC1CC(C(C(O1)C)NC(=O)C)(C)O)C |