2-Fluoro-I CEP
2-Fluoro-I CEP, a powerful biomedical agent, is widely utilized in therapeutic applications against diverse ailments. Its role encompasses inhibiting specific enzymes and receptors, particularly those implicated in the advancement of neoplastic conditions and the proliferation of tumors. By virtue of its precise targeting mechanism, 2-Fluoro-I CEP exhibits remarkable potential in impeding the proliferation and metastasis of tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 220382-27-4 |
| Pricing | Inquire |
| Cas | 220382-27-4 |
| Molecular Weight | 1052.22 |
| Molecular Formula | C54H67FN7O10PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=NC3=C2N=C(N=C3OCCC4=CC=C(C=C4)[N+](=O)[O-])F)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |