MEN 10376
| Supplier | Creative Peptides |
|---|---|
| Product # | R1024 |
| CAS # | 135306-85-3 |
| Pricing | Inquire |
| LabelingTarget | NK2 Receptors |
| BoilingPoint | 1555.4ºC at 760 mmHg |
| MolecularFormula | C57H68N12O10 |
| MolecularWeight | 1081.24 |
| Sequence | Asp-Tyr-DTrp-Val-DTrp-DTrp-Lys-NH2 |
| Storage | -20°C |
| ShippingCondition | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. |
| Explanation | Potent, highly selective NK2 neurokinin receptor antagonist. |
| Activity | Antagonist |
| InChI | InChI=1S/C57H68N12O10/c1-31(2)50(69-56(78)48(26-35-30-63-43-16-8-5-13-39(35)43)67-53(75)45(23-32-18-20-36(70)21-19-32)65-52(74)40(59)27-49(71)72)57(79)68-47(25-34-29-62-42-15-7-4-12-38(34)42)55(77)66-46(24-33-28-61-41-14-6-3-11-37(33)41)54(76)64-44(51(60)73)17-9-10-22-58/h3-8,11-16,18-21,28-31,40,44-48,50,61-63,70H,9-10,17,22-27,58-59H2,1-2H3,(H2,60,73)(H,64,76)(H,65,74)(H,66,77)(H,67,75)(H,68,79)(H,69,78)(H,71,72)/t40-,44-,45-,46+,47+,48+,50-/m0/s1 |
| InChIKey | QQHOFZNACVKNHK-SXVLBCBNSA-N |
| Solubility | Soluble in Water |
| IsomericSMILES | CC(C)[C@@H](C(=O)N[C@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@H](CC3=CNC4=CC=CC=C43)C(=O)N[C@@H](CCCCN)C(=O)N)NC(=O)[C@@H](CC5=CNC6=CC=CC=C65)NC(=O)[C@H](CC7=CC=C(C=C7)O)NC(=O)[C@H](CC(=O)O)N |
| Appearance | Off-white lyophilised solid |
| Purity | >99% |
| ShortTermStorageConditions | Dry, dark and at 0 - 4 °C |
| LongTermStorageConditions | -20 °C |