Benzoylcholine chloride
Benzoylcholine chloride, a pivotal pharmaceutical compound in the biomedical sector, unveils its paramount significance. Its foremost application revolves around targeting neurological disorders, particularly myasthenia gravis. By acting as an inhibitory force on the formidable enzyme acetylcholinesterase, it exudes its prowess in augmenting cholinergic neurotransmission.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2964-09-2 |
| Pricing | Inquire |
| Cas | 2964-09-2 |
| Molecular Weight | 243.73 |
| Molecular Formula | C12H18ClNO2 |
| Canonical SMILES | C[N+](C)(C)CCOC(=O)C1=CC=CC=C1.[Cl-] |