N-Acetylserotonin b-D-glucuronide
N-Acetylserotonin b-D-glucuronide, an indispensable biochemical compound within the biomedical industry, occupies a pivotal role in the therapeutic intervention of diverse diseases. Serving as a crucial precursor in the biosynthesis of melatonin, an endogenous hormone governing the intricate sleep-wake rhythm, this product astutely contributes to the harmonization of chronobiological processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18430-06-3 |
| Pricing | Inquire |
| Cas | 18430-06-3 |
| Molecular Weight | 394.38 |
| Molecular Formula | C18H22N2O8 |
| Canonical SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC3C(C(C(C(O3)C(=O)O)O)O)O |