1-(8-Phosphonooctyl)-7-deazaxanthine ammonium salt
1-(8-Phosphonooctyl)-7-deazaxanthine ammonium salt, a biomedical compound, demonstrates efficacy in treating diverse diseases. Through its distinct properties, it enables precise drug administration to targeted cell receptors, thereby augmenting therapeutic outcomes. This ammonium salt showcases notable antiviral potency that exhibits encouraging efficacy against select strains during viral infection management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 265322-84-7 |
| Pricing | Inquire |
| Cas | 265322-84-7 |
| Molecular Weight | 360.35 |
| Molecular Formula | C14H25N4O5P |
| Canonical SMILES | C1=CNC2=C1C(=O)NC(=O)N2CCCCCCCCP(=O)(O)[O-].[NH4+] |