Cyanidin chloride
Cyanidin Chloride is a natural anthocyanidin found in a variety of fruits and vegetables. This polyphenolic compound is a flavonoid with significant antioxidant activity. Cyanidin Chloride and its glycosides have vasoprotective effects and can interfere with inflammation, carcinogenesis, obesity, and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-464468 |
| Pricing | Inquire |
| Cas | 528-58-5 |
| Molecular Weight | 322.70 |
| Molecular Formula | C15H11O6Cl |
| Canonical SMILES | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-] |