4-Methylumbelliferyl 2-acetamido-2-deoxy-3-O-(a-L-fucopyranosyl)-b-D-glucopyranoside
4-Methylumbelliferyl 2-acetamido-2-deoxy-3-O-(a-L-fucopyranosyl)-b-D-glucopyranoside, an essential biochemical compound within the biomedical industry, is instrumental for the detection and measurement of the alpha-L-fucosidase enzyme's activity. Its wide-ranging utility encompasses the exploration of lysosomal storage disorders and glycosylation disorders, particularly fucosidosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383160-12-1 |
| Pricing | Inquire |
| Cas | 383160-12-1 |
| Molecular Weight | 525.5 |
| Molecular Formula | C24H31NO12 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2O)CO)OC3=CC4=C(C=C3)C(=CC(=O)O4)C)NC(=O)C)O)O)O |