2'-Deoxy-5'-O-DMT-N4-ethylcytidine 3'-CE phosphoramidite
2'-Deoxy-5'-O-DMT-N4-ethylcytidine 3'-CE phosphoramidite is a vital tool in the biomedical industry used for the synthesis of oligonucleotides. This phosphoramidite derivative acting as a building block, enabling the efficient incorporation of 2'-deoxy-5'-O-DMT-N4-ethylcytidine into DNA strands during solid-phase synthesis. It finding applications in researching and developing therapeutic strategies for various diseases at the molecular level.
| Supplier | BOC Sciences |
|---|---|
| Product # | 195535-80-9 |
| Pricing | Inquire |
| Cas | 195535-80-9 |
| Molecular Weight | 757.87 |
| Molecular Formula | C41H52N5O7P |
| Canonical SMILES | CCNC1=NC(=O)N(C=C1)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N |