3'-Amino-3'-deoxycytidine
3'-Amino-3'-deoxycytidine, an indispensable tool in the biomedical sector, showcases noteworthiness in academic and scientific domains. This nucleoside analog, being a potent antiviral agent, exhibits tremendous efficacy against viral ailments, including hepatitis B and human immunodeficiency virus (HIV). Profoundly mirroring natural nucleosides, this compound selectively infiltrates viral DNA, impeding viral replication comprehensively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70580-89-1 |
| Pricing | Inquire |
| Cas | 70580-89-1 |
| Molecular Weight | 242.23 |
| Molecular Formula | C9H14N4O4 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)N)O |