Ceranib 1
Ceranib 1 is a ceramidase inhibitor. It inhibits proliferation in SKOV3 ovarian carcinoma cells. It decreases sphingosine and sphingosine-1-phosphate (S1P) levels in SKOV3 cells and induces accumulation of ceramide species. It is a useful research chemical and has an antiproliferative effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | 328076-61-5 |
| Pricing | Inquire |
| Cas | 328076-61-5 |
| Molecular Weight | 395.45 |
| Molecular Formula | C26H21NO3 |
| Canonical SMILES | CC1=CC2=C(C=C1)NC(=O)C(=C2C3=CC=CC=C3)C(=O)C=CC4=CC=C(C=C4)OC |