N-Benzoyl-2'-deoxy-5'-O-trityladenosine
N-Benzoyl-2'-deoxy-5'-O-trityladenosine is a chemical compound used in biomedical research as a reference standard for the testing and development of nucleoside analogues. It has been shown to have potential in the treatment of viral infections and cancer due to its ability to inhibit RNA synthesis. Studies have also suggested its potential use in gene therapy due to its ability to penetrate cell membranes and deliver genetic material.
Supplier | BOC Sciences |
---|---|
Product # | 75759-62-5 |
Pricing | Inquire |
Cas | 75759-62-5 |
Molecular Weight | 597.67 |
Molecular Formula | C36H31N5O4 |
Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)O |